C14H18O8 — CID 15307009
2-[2-[4-[2-(carboxymethoxy)ethoxy]phenoxy]ethoxy]acetic acid (PubChem CID 15307009) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is 2-[2-[4-[2-(carboxymethoxy)ethoxy]phenoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-[2-(carboxymethoxy)ethoxy]phenoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 15307009 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-[2-[4-[2-(carboxymethoxy)ethoxy]phenoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOc1ccc(OCCOCC(=O)O)cc1 |
| InChI | InChI=1S/C14H18O8/c15-13(16)9-19-5-7-21-11-1-2-12(4-3-11)22-8-6-20-10-14(17)18/h1-4H,5-10H2,(H,15,16)(H,17,18) |
| InChIKey | NNSIEXCPPLUSTA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|