C40H56O9 — CID 101371720
2-[2-[2-[2-[2-[2,5-bis(4-hexoxyphenyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 101371720) has the molecular formula C40H56O9 and a molecular weight of 680.88 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2,5-bis(4-hexoxyphenyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[2-[2,5-bis(4-hexoxyphenyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 101371720 |
| Molecular Formula | C40H56O9 |
| Molecular Weight | 680.88 g/mol |
| Exact Mass | 680.39 |
| IUPAC Name | 2-[2-[2-[2-[2-[2,5-bis(4-hexoxyphenyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | CCCCCCOc1ccc(-c2ccc(-c3ccc(OCCCCCC)cc3)c(OCCOCCOCCOCCOCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C40H56O9/c1-3-5-7-9-21-47-36-16-11-33(12-17-36)35-15-20-38(34-13-18-37(19-14-34)48-22-10-8-6-4-2)39(31-35)49-30-29-45-26-25-43-23-24-44-27-28-46-32-40(41)42/h11-20,31H,3-10,21-30,32H2,1-2H3,(H,41,42) |
| InChIKey | XLWRBJRYBPGSGA-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.88 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|