C32H41NO5 — CID 155012530
tert-butyl-[3-[5-methoxy-2-[4-(4-pentoxyphenyl)phenyl]phenoxy]propyl]carbamic acid (PubChem CID 155012530) has the molecular formula C32H41NO5 and a molecular weight of 519.68 g/mol. Its IUPAC name is tert-butyl-[3-[5-methoxy-2-[4-(4-pentoxyphenyl)phenyl]phenoxy]propyl]carbamic acid.
| Compound Name | tert-butyl-[3-[5-methoxy-2-[4-(4-pentoxyphenyl)phenyl]phenoxy]propyl]carbamic acid |
|---|---|
| PubChem CID | 155012530 |
| Molecular Formula | C32H41NO5 |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | tert-butyl-[3-[5-methoxy-2-[4-(4-pentoxyphenyl)phenyl]phenoxy]propyl]carbamic acid |
| SMILES | CCCCCOc1ccc(-c2ccc(-c3ccc(OC)cc3OCCCN(C(=O)O)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H41NO5/c1-6-7-8-21-37-27-16-14-25(15-17-27)24-10-12-26(13-11-24)29-19-18-28(36-5)23-30(29)38-22-9-20-33(31(34)35)32(2,3)4/h10-19,23H,6-9,20-22H2,1-5H3,(H,34,35) |
| InChIKey | ZBZLGOHWVUILMS-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|