C27H40N2O5 — CID 154422073
3-(2,4-dimethoxyphenyl)-1-heptyl-1-[[4-(4-hydroxybutoxy)phenyl]methyl]urea (PubChem CID 154422073) has the molecular formula C27H40N2O5 and a molecular weight of 472.63 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1-heptyl-1-[[4-(4-hydroxybutoxy)phenyl]methyl]urea.
| Compound Name | 3-(2,4-dimethoxyphenyl)-1-heptyl-1-[[4-(4-hydroxybutoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 154422073 |
| Molecular Formula | C27H40N2O5 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-1-heptyl-1-[[4-(4-hydroxybutoxy)phenyl]methyl]urea |
| SMILES | CCCCCCCN(Cc1ccc(OCCCCO)cc1)C(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C27H40N2O5/c1-4-5-6-7-8-17-29(21-22-11-13-23(14-12-22)34-19-10-9-18-30)27(31)28-25-16-15-24(32-2)20-26(25)33-3/h11-16,20,30H,4-10,17-19,21H2,1-3H3,(H,28,31) |
| InChIKey | AQYBTNFNPOLAJE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|