C27H30N2O5 — CID 175325666
methyl 4-[[4-hydroxybutyl-[(2-methoxy-4-phenylphenyl)carbamoyl]amino]methyl]benzoate (PubChem CID 175325666) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is methyl 4-[[4-hydroxybutyl-[(2-methoxy-4-phenylphenyl)carbamoyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[4-hydroxybutyl-[(2-methoxy-4-phenylphenyl)carbamoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 175325666 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | methyl 4-[[4-hydroxybutyl-[(2-methoxy-4-phenylphenyl)carbamoyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(CCCCO)C(=O)Nc2ccc(-c3ccccc3)cc2OC)cc1 |
| InChI | InChI=1S/C27H30N2O5/c1-33-25-18-23(21-8-4-3-5-9-21)14-15-24(25)28-27(32)29(16-6-7-17-30)19-20-10-12-22(13-11-20)26(31)34-2/h3-5,8-15,18,30H,6-7,16-17,19H2,1-2H3,(H,28,32) |
| InChIKey | LFLSKPQLMQLDCO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|