C16H16O4 — CID 14570120
methyl 4-(3,4-dimethoxyphenyl)benzoate (PubChem CID 14570120) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl 4-(3,4-dimethoxyphenyl)benzoate.
| Compound Name | methyl 4-(3,4-dimethoxyphenyl)benzoate |
|---|---|
| PubChem CID | 14570120 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | methyl 4-(3,4-dimethoxyphenyl)benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C16H16O4/c1-18-14-9-8-13(10-15(14)19-2)11-4-6-12(7-5-11)16(17)20-3/h4-10H,1-3H3 |
| InChIKey | MVDHOJUHRYPXIP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |