methyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate

C17H18O5 — CID 15186062

IUPACmethyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate
SMILESCOC(=O)c1ccc(OCc2ccc(OC)c(OC)c2)cc1
InChIInChI=1S/C17H18O5/c1-19-15-9-4-12(10-16(15)20-2)11-22-14-7-5-13(6-8-14)17(18)21-3/h4-10H,11H2,1-3H3
InChIKeyBCGQHKYTPWWUAD-UHFFFAOYSA-N
MW302.33 g/mol
LogP3.07
Rot. Bonds6

About methyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate

methyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate (PubChem CID 15186062) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is methyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate.

Molecular Properties

Compound Namemethyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate
PubChem CID15186062
Molecular FormulaC17H18O5
Molecular Weight302.33 g/mol
Exact Mass302.12
IUPAC Namemethyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate
SMILESCOC(=O)c1ccc(OCc2ccc(OC)c(OC)c2)cc1
InChIInChI=1S/C17H18O5/c1-19-15-9-4-12(10-16(15)20-2)11-22-14-7-5-13(6-8-14)17(18)21-3/h4-10H,11H2,1-3H3
InChIKeyBCGQHKYTPWWUAD-UHFFFAOYSA-N
XLogP3.07
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.33
LogP ≤ 53.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate?
The IUPAC name of methyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate (CID 15186062) is methyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate.
What is the SMILES notation for methyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate?
The canonical SMILES for methyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate is COC(=O)c1ccc(OCc2ccc(OC)c(OC)c2)cc1.
What is the InChIKey of methyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate?
The InChIKey is BCGQHKYTPWWUAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O5/c1-19-15-9-4-12(10-16(15)20-2)11-22-14-7-5-13(6-8-14)17(18)21-3/h4-10H,11H2,1-3H3.
What are the key properties of methyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate?
methyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate has a molecular weight of 302.33 g/mol, XLogP of 3.07, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate is sourced from PubChem (CID 15186062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).