C88H80O12 — CID 59204228
methyl 4-[3,5-bis[[3,4-bis[[4-[(4-methylphenyl)methoxy]phenyl]methoxy]phenyl]methoxy]phenyl]benzoate (PubChem CID 59204228) has the molecular formula C88H80O12 and a molecular weight of 1329.60 g/mol. Its IUPAC name is methyl 4-[3,5-bis[[3,4-bis[[4-[(4-methylphenyl)methoxy]phenyl]methoxy]phenyl]methoxy]phenyl]benzoate.
| Compound Name | methyl 4-[3,5-bis[[3,4-bis[[4-[(4-methylphenyl)methoxy]phenyl]methoxy]phenyl]methoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 59204228 |
| Molecular Formula | C88H80O12 |
| Molecular Weight | 1329.60 g/mol |
| Exact Mass | 1328.56 |
| IUPAC Name | methyl 4-[3,5-bis[[3,4-bis[[4-[(4-methylphenyl)methoxy]phenyl]methoxy]phenyl]methoxy]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(OCc3ccc(OCc4ccc(OCc5ccc(C)cc5)cc4)c(OCc4ccc(OCc5ccc(C)cc5)cc4)c3)cc(OCc3ccc(OCc4ccc(OCc5ccc(C)cc5)cc4)c(OCc4ccc(OCc5ccc(C)cc5)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C88H80O12/c1-61-6-14-65(15-7-61)51-91-78-36-22-69(23-37-78)55-97-84-44-30-73(46-86(84)99-57-71-26-40-80(41-27-71)93-53-67-18-10-63(3)11-19-67)59-95-82-48-77(75-32-34-76(35-33-75)88(89)90-5)49-83(50-82)96-60-74-31-45-85(98-56-70-24-38-79(39-25-70)92-52-66-16-8-62(2)9-17-66)87(47-74)100-58-72-28-42-81(43-29-72)94-54-68-20-12-64(4)13-21-68/h6-50H,51-60H2,1-5H3 |
| InChIKey | DNTYXJGATKHJHG-UHFFFAOYSA-N |
| XLogP | 20.16 |
| TPSA | 118.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 100 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1329.60 |
| LogP ≤ 5 | 20.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |