C61H60O7 — CID 58627170
1,3-bis[[3,4-bis[(4-methylphenyl)methoxy]phenyl]methoxy]-5-[(4-ethylphenoxy)methyl]benzene (PubChem CID 58627170) has the molecular formula C61H60O7 and a molecular weight of 905.14 g/mol. Its IUPAC name is 1,3-bis[[3,4-bis[(4-methylphenyl)methoxy]phenyl]methoxy]-5-[(4-ethylphenoxy)methyl]benzene.
| Compound Name | 1,3-bis[[3,4-bis[(4-methylphenyl)methoxy]phenyl]methoxy]-5-[(4-ethylphenoxy)methyl]benzene |
|---|---|
| PubChem CID | 58627170 |
| Molecular Formula | C61H60O7 |
| Molecular Weight | 905.14 g/mol |
| Exact Mass | 904.43 |
| IUPAC Name | 1,3-bis[[3,4-bis[(4-methylphenyl)methoxy]phenyl]methoxy]-5-[(4-ethylphenoxy)methyl]benzene |
| SMILES | CCc1ccc(OCc2cc(OCc3ccc(OCc4ccc(C)cc4)c(OCc4ccc(C)cc4)c3)cc(OCc3ccc(OCc4ccc(C)cc4)c(OCc4ccc(C)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C61H60O7/c1-6-47-23-27-55(28-24-47)62-42-54-31-56(63-40-52-25-29-58(65-36-48-15-7-43(2)8-16-48)60(33-52)67-38-50-19-11-45(4)12-20-50)35-57(32-54)64-41-53-26-30-59(66-37-49-17-9-44(3)10-18-49)61(34-53)68-39-51-21-13-46(5)14-22-51/h7-35H,6,36-42H2,1-5H3 |
| InChIKey | LWVXOUUKVXVCQV-UHFFFAOYSA-N |
| XLogP | 14.54 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.14 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |