C15H15IO3 — CID 61400160
4-[(4-iodophenoxy)methyl]-1,2-dimethoxybenzene (PubChem CID 61400160) has the molecular formula C15H15IO3 and a molecular weight of 370.19 g/mol. Its IUPAC name is 4-[(4-iodophenoxy)methyl]-1,2-dimethoxybenzene.
| Compound Name | 4-[(4-iodophenoxy)methyl]-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 61400160 |
| Molecular Formula | C15H15IO3 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 4-[(4-iodophenoxy)methyl]-1,2-dimethoxybenzene |
| SMILES | COc1ccc(COc2ccc(I)cc2)cc1OC |
| InChI | InChI=1S/C15H15IO3/c1-17-14-8-3-11(9-15(14)18-2)10-19-13-6-4-12(16)5-7-13/h3-9H,10H2,1-2H3 |
| InChIKey | PMCKWNINKFQNFJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|