C24H24INO4 — CID 4842945
N-[(3,4-dimethoxyphenyl)methyl]-2-[4-(4-iodophenyl)phenoxy]-N-methylacetamide (PubChem CID 4842945) has the molecular formula C24H24INO4 and a molecular weight of 517.36 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-[4-(4-iodophenyl)phenoxy]-N-methylacetamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[4-(4-iodophenyl)phenoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 4842945 |
| Molecular Formula | C24H24INO4 |
| Molecular Weight | 517.36 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[4-(4-iodophenyl)phenoxy]-N-methylacetamide |
| SMILES | COc1ccc(CN(C)C(=O)COc2ccc(-c3ccc(I)cc3)cc2)cc1OC |
| InChI | InChI=1S/C24H24INO4/c1-26(15-17-4-13-22(28-2)23(14-17)29-3)24(27)16-30-21-11-7-19(8-12-21)18-5-9-20(25)10-6-18/h4-14H,15-16H2,1-3H3 |
| InChIKey | UYKPEZBVVJBBKW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|