C21H24FNO4 — CID 78796591
N-[(3-fluoro-4-methoxyphenyl)methyl]-2-(2-methoxy-4-prop-2-enylphenoxy)-N-methylacetamide (PubChem CID 78796591) has the molecular formula C21H24FNO4 and a molecular weight of 373.42 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-2-(2-methoxy-4-prop-2-enylphenoxy)-N-methylacetamide.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-2-(2-methoxy-4-prop-2-enylphenoxy)-N-methylacetamide |
|---|---|
| PubChem CID | 78796591 |
| Molecular Formula | C21H24FNO4 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-2-(2-methoxy-4-prop-2-enylphenoxy)-N-methylacetamide |
| SMILES | C=CCc1ccc(OCC(=O)N(C)Cc2ccc(OC)c(F)c2)c(OC)c1 |
| InChI | InChI=1S/C21H24FNO4/c1-5-6-15-7-10-19(20(12-15)26-4)27-14-21(24)23(2)13-16-8-9-18(25-3)17(22)11-16/h5,7-12H,1,6,13-14H2,2-4H3 |
| InChIKey | YKEQFTLJGCCQLW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|