C21H23NO5 — CID 17414877
N-(1,3-benzodioxol-5-ylmethyl)-2-(2-methoxy-4-prop-2-enylphenoxy)-N-methylacetamide (PubChem CID 17414877) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(2-methoxy-4-prop-2-enylphenoxy)-N-methylacetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(2-methoxy-4-prop-2-enylphenoxy)-N-methylacetamide |
|---|---|
| PubChem CID | 17414877 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(2-methoxy-4-prop-2-enylphenoxy)-N-methylacetamide |
| SMILES | C=CCc1ccc(OCC(=O)N(C)Cc2ccc3c(c2)OCO3)c(OC)c1 |
| InChI | InChI=1S/C21H23NO5/c1-4-5-15-6-8-17(19(10-15)24-3)25-13-21(23)22(2)12-16-7-9-18-20(11-16)27-14-26-18/h4,6-11H,1,5,12-14H2,2-3H3 |
| InChIKey | VLPPDWYCSIFNBM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|