C19H22ClNO4 — CID 6457612
1-(1,3-benzodioxol-5-yl)-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]methanamine;hydrochloride (PubChem CID 6457612) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]methanamine;hydrochloride.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 6457612 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]methanamine;hydrochloride |
| SMILES | C=CCOc1ccc(CNCc2ccc3c(c2)OCO3)cc1OC.Cl |
| InChI | InChI=1S/C19H21NO4.ClH/c1-3-8-22-16-6-4-14(9-18(16)21-2)11-20-12-15-5-7-17-19(10-15)24-13-23-17;/h3-7,9-10,20H,1,8,11-13H2,2H3;1H |
| InChIKey | RLDMXUPCDAWBNL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|