C21H25NO4 — CID 119123311
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]methanamine (PubChem CID 119123311) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]methanamine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 119123311 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]methanamine |
| SMILES | C=CCc1cc(CNCc2ccc3c(c2)OCCO3)cc(OC)c1OC |
| InChI | InChI=1S/C21H25NO4/c1-4-5-17-10-16(12-20(23-2)21(17)24-3)14-22-13-15-6-7-18-19(11-15)26-9-8-25-18/h4,6-7,10-12,22H,1,5,8-9,13-14H2,2-3H3 |
| InChIKey | NBANXQXOUNNKQK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|