C20H22N2O2 — CID 119123274
4-[[(3,4-dimethoxy-5-prop-2-enylphenyl)methylamino]methyl]benzonitrile (PubChem CID 119123274) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-[[(3,4-dimethoxy-5-prop-2-enylphenyl)methylamino]methyl]benzonitrile.
| Compound Name | 4-[[(3,4-dimethoxy-5-prop-2-enylphenyl)methylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 119123274 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 4-[[(3,4-dimethoxy-5-prop-2-enylphenyl)methylamino]methyl]benzonitrile |
| SMILES | C=CCc1cc(CNCc2ccc(C#N)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H22N2O2/c1-4-5-18-10-17(11-19(23-2)20(18)24-3)14-22-13-16-8-6-15(12-21)7-9-16/h4,6-11,22H,1,5,13-14H2,2-3H3 |
| InChIKey | IHRNNNSYKMEUOA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|