C20H22N2O2S2 — CID 119123247
1-(3,4-dimethoxy-5-prop-2-enylphenyl)-N-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]methanamine (PubChem CID 119123247) has the molecular formula C20H22N2O2S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-(3,4-dimethoxy-5-prop-2-enylphenyl)-N-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]methanamine.
| Compound Name | 1-(3,4-dimethoxy-5-prop-2-enylphenyl)-N-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 119123247 |
| Molecular Formula | C20H22N2O2S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-(3,4-dimethoxy-5-prop-2-enylphenyl)-N-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]methanamine |
| SMILES | C=CCc1cc(CNCc2csc(-c3ccsc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H22N2O2S2/c1-4-5-15-8-14(9-18(23-2)19(15)24-3)10-21-11-17-13-26-20(22-17)16-6-7-25-12-16/h4,6-9,12-13,21H,1,5,10-11H2,2-3H3 |
| InChIKey | HKEMOZOFRMHVKG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|