C20H24FNO2 — CID 17213394
N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-1-(4-fluorophenyl)methanamine (PubChem CID 17213394) has the molecular formula C20H24FNO2 and a molecular weight of 329.42 g/mol. Its IUPAC name is N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-1-(4-fluorophenyl)methanamine.
| Compound Name | N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-1-(4-fluorophenyl)methanamine |
|---|---|
| PubChem CID | 17213394 |
| Molecular Formula | C20H24FNO2 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-1-(4-fluorophenyl)methanamine |
| SMILES | C=CCc1cc(CNCc2ccc(F)cc2)cc(OC)c1OCC |
| InChI | InChI=1S/C20H24FNO2/c1-4-6-17-11-16(12-19(23-3)20(17)24-5-2)14-22-13-15-7-9-18(21)10-8-15/h4,7-12,22H,1,5-6,13-14H2,2-3H3 |
| InChIKey | SNPCIVXBLYNVDW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|