C24H42N2O2 — CID 17214907
N',N'-dibutyl-N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]propane-1,3-diamine (PubChem CID 17214907) has the molecular formula C24H42N2O2 and a molecular weight of 390.61 g/mol. Its IUPAC name is N',N'-dibutyl-N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]propane-1,3-diamine.
| Compound Name | N',N'-dibutyl-N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 17214907 |
| Molecular Formula | C24H42N2O2 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | N',N'-dibutyl-N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]propane-1,3-diamine |
| SMILES | C=CCc1cc(CNCCCN(CCCC)CCCC)cc(OC)c1OCC |
| InChI | InChI=1S/C24H42N2O2/c1-6-10-15-26(16-11-7-2)17-12-14-25-20-21-18-22(13-8-3)24(28-9-4)23(19-21)27-5/h8,18-19,25H,3,6-7,9-17,20H2,1-2,4-5H3 |
| InChIKey | PWSJKTXZQRGNLP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|