C22H39ClN2O2 — CID 17214660
N',N'-dibutyl-N-[(3-chloro-4,5-diethoxyphenyl)methyl]propane-1,3-diamine (PubChem CID 17214660) has the molecular formula C22H39ClN2O2 and a molecular weight of 399.02 g/mol. Its IUPAC name is N',N'-dibutyl-N-[(3-chloro-4,5-diethoxyphenyl)methyl]propane-1,3-diamine.
| Compound Name | N',N'-dibutyl-N-[(3-chloro-4,5-diethoxyphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 17214660 |
| Molecular Formula | C22H39ClN2O2 |
| Molecular Weight | 399.02 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | N',N'-dibutyl-N-[(3-chloro-4,5-diethoxyphenyl)methyl]propane-1,3-diamine |
| SMILES | CCCCN(CCCC)CCCNCc1cc(Cl)c(OCC)c(OCC)c1 |
| InChI | InChI=1S/C22H39ClN2O2/c1-5-9-13-25(14-10-6-2)15-11-12-24-18-19-16-20(23)22(27-8-4)21(17-19)26-7-3/h16-17,24H,5-15,18H2,1-4H3 |
| InChIKey | WKEJKMPSDOJEKN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.02 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|