C16H26Cl3NO — CID 17157748
N-[(3,5-dichloro-4-ethoxyphenyl)methyl]heptan-1-amine;hydrochloride (PubChem CID 17157748) has the molecular formula C16H26Cl3NO and a molecular weight of 354.75 g/mol. Its IUPAC name is N-[(3,5-dichloro-4-ethoxyphenyl)methyl]heptan-1-amine;hydrochloride.
| Compound Name | N-[(3,5-dichloro-4-ethoxyphenyl)methyl]heptan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17157748 |
| Molecular Formula | C16H26Cl3NO |
| Molecular Weight | 354.75 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-[(3,5-dichloro-4-ethoxyphenyl)methyl]heptan-1-amine;hydrochloride |
| SMILES | CCCCCCCNCc1cc(Cl)c(OCC)c(Cl)c1.Cl |
| InChI | InChI=1S/C16H25Cl2NO.ClH/c1-3-5-6-7-8-9-19-12-13-10-14(17)16(20-4-2)15(18)11-13;/h10-11,19H,3-9,12H2,1-2H3;1H |
| InChIKey | BCXGFILPYRHINH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.75 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|