C17H27Cl2NO2 — CID 29223105
3-butoxy-N-[(3,5-dichloro-4-propoxyphenyl)methyl]propan-1-amine (PubChem CID 29223105) has the molecular formula C17H27Cl2NO2 and a molecular weight of 348.31 g/mol. Its IUPAC name is 3-butoxy-N-[(3,5-dichloro-4-propoxyphenyl)methyl]propan-1-amine.
| Compound Name | 3-butoxy-N-[(3,5-dichloro-4-propoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 29223105 |
| Molecular Formula | C17H27Cl2NO2 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-butoxy-N-[(3,5-dichloro-4-propoxyphenyl)methyl]propan-1-amine |
| SMILES | CCCCOCCCNCc1cc(Cl)c(OCCC)c(Cl)c1 |
| InChI | InChI=1S/C17H27Cl2NO2/c1-3-5-9-21-10-6-7-20-13-14-11-15(18)17(16(19)12-14)22-8-4-2/h11-12,20H,3-10,13H2,1-2H3 |
| InChIKey | HWGMLGGMRNQVQH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|