C24H34ClNO3 — CID 17207881
3-butoxy-N-[[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine (PubChem CID 17207881) has the molecular formula C24H34ClNO3 and a molecular weight of 419.99 g/mol. Its IUPAC name is 3-butoxy-N-[[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine.
| Compound Name | 3-butoxy-N-[[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 17207881 |
| Molecular Formula | C24H34ClNO3 |
| Molecular Weight | 419.99 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 3-butoxy-N-[[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine |
| SMILES | CCCCOCCCNCc1cc(Cl)c(OCc2ccc(C)cc2)c(OCC)c1 |
| InChI | InChI=1S/C24H34ClNO3/c1-4-6-13-27-14-7-12-26-17-21-15-22(25)24(23(16-21)28-5-2)29-18-20-10-8-19(3)9-11-20/h8-11,15-16,26H,4-7,12-14,17-18H2,1-3H3 |
| InChIKey | IDOOUCGXOXQFTH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.99 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|