C20H27Cl2NO2 — CID 17289469
N-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methyl]butan-1-amine;hydrochloride (PubChem CID 17289469) has the molecular formula C20H27Cl2NO2 and a molecular weight of 384.35 g/mol. Its IUPAC name is N-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methyl]butan-1-amine;hydrochloride.
| Compound Name | N-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17289469 |
| Molecular Formula | C20H27Cl2NO2 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methyl]butan-1-amine;hydrochloride |
| SMILES | CCCCNCc1cc(Cl)c(OCc2ccccc2)c(OCC)c1.Cl |
| InChI | InChI=1S/C20H26ClNO2.ClH/c1-3-5-11-22-14-17-12-18(21)20(19(13-17)23-4-2)24-15-16-9-7-6-8-10-16;/h6-10,12-13,22H,3-5,11,14-15H2,1-2H3;1H |
| InChIKey | RIUUUTYEMCPXJY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|