C16H26Cl2N2O — CID 29241424
N-[(3,5-dichloro-4-propoxyphenyl)methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 29241424) has the molecular formula C16H26Cl2N2O and a molecular weight of 333.30 g/mol. Its IUPAC name is N-[(3,5-dichloro-4-propoxyphenyl)methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[(3,5-dichloro-4-propoxyphenyl)methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 29241424 |
| Molecular Formula | C16H26Cl2N2O |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-[(3,5-dichloro-4-propoxyphenyl)methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCCOc1c(Cl)cc(CNCCN(CC)CC)cc1Cl |
| InChI | InChI=1S/C16H26Cl2N2O/c1-4-9-21-16-14(17)10-13(11-15(16)18)12-19-7-8-20(5-2)6-3/h10-11,19H,4-9,12H2,1-3H3 |
| InChIKey | NINBQXRRGPEXPQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|