C13H22Cl4N2 — CID 17294365
N-[(3,4-dichlorophenyl)methyl]-N',N'-diethylethane-1,2-diamine;dihydrochloride (PubChem CID 17294365) has the molecular formula C13H22Cl4N2 and a molecular weight of 348.15 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N',N'-diethylethane-1,2-diamine;dihydrochloride.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N',N'-diethylethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17294365 |
| Molecular Formula | C13H22Cl4N2 |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N',N'-diethylethane-1,2-diamine;dihydrochloride |
| SMILES | CCN(CC)CCNCc1ccc(Cl)c(Cl)c1.Cl.Cl |
| InChI | InChI=1S/C13H20Cl2N2.2ClH/c1-3-17(4-2)8-7-16-10-11-5-6-12(14)13(15)9-11;;/h5-6,9,16H,3-4,7-8,10H2,1-2H3;2*1H |
| InChIKey | NLESORULLXHSHW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|