C11H16Cl2N2 — CID 5222337
N-[(3,4-dichlorophenyl)methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 5222337) has the molecular formula C11H16Cl2N2 and a molecular weight of 247.17 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 5222337 |
| Molecular Formula | C11H16Cl2N2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H16Cl2N2/c1-15(2)6-5-14-8-9-3-4-10(12)11(13)7-9/h3-4,7,14H,5-6,8H2,1-2H3 |
| InChIKey | NYSHFAAKOUWIBE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|