C11H15Cl2NO2S — CID 103643069
N-[(3,4-dichlorophenyl)methyl]-2-ethylsulfonylethanamine (PubChem CID 103643069) has the molecular formula C11H15Cl2NO2S and a molecular weight of 296.22 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-2-ethylsulfonylethanamine.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-2-ethylsulfonylethanamine |
|---|---|
| PubChem CID | 103643069 |
| Molecular Formula | C11H15Cl2NO2S |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-2-ethylsulfonylethanamine |
| SMILES | CCS(=O)(=O)CCNCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H15Cl2NO2S/c1-2-17(15,16)6-5-14-8-9-3-4-10(12)11(13)7-9/h3-4,7,14H,2,5-6,8H2,1H3 |
| InChIKey | DMXZYCLDVFKDNP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|