C10H14Cl2N2 — CID 18353717
N'-[(3,4-dichlorophenyl)methyl]propane-1,3-diamine (PubChem CID 18353717) has the molecular formula C10H14Cl2N2 and a molecular weight of 233.14 g/mol. Its IUPAC name is N'-[(3,4-dichlorophenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-[(3,4-dichlorophenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 18353717 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | N'-[(3,4-dichlorophenyl)methyl]propane-1,3-diamine |
| SMILES | NCCCNCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H14Cl2N2/c11-9-3-2-8(6-10(9)12)7-14-5-1-4-13/h2-3,6,14H,1,4-5,7,13H2 |
| InChIKey | VZFQZLMHBJTQLK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|