C12H20Cl4N2 — CID 17294130
N-[(3,4-dichlorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride (PubChem CID 17294130) has the molecular formula C12H20Cl4N2 and a molecular weight of 334.12 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17294130 |
| Molecular Formula | C12H20Cl4N2 |
| Molecular Weight | 334.12 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CN(C)CCCNCc1ccc(Cl)c(Cl)c1.Cl.Cl |
| InChI | InChI=1S/C12H18Cl2N2.2ClH/c1-16(2)7-3-6-15-9-10-4-5-11(13)12(14)8-10;;/h4-5,8,15H,3,6-7,9H2,1-2H3;2*1H |
| InChIKey | SAENBWBLTDSZOX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.12 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|