C14H22Cl2N2O2 — CID 174912165
2-[3-[(3,4-dichlorophenyl)methylamino]propyl-ethoxyamino]ethanol (PubChem CID 174912165) has the molecular formula C14H22Cl2N2O2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 2-[3-[(3,4-dichlorophenyl)methylamino]propyl-ethoxyamino]ethanol.
| Compound Name | 2-[3-[(3,4-dichlorophenyl)methylamino]propyl-ethoxyamino]ethanol |
|---|---|
| PubChem CID | 174912165 |
| Molecular Formula | C14H22Cl2N2O2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-[3-[(3,4-dichlorophenyl)methylamino]propyl-ethoxyamino]ethanol |
| SMILES | CCON(CCO)CCCNCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H22Cl2N2O2/c1-2-20-18(8-9-19)7-3-6-17-11-12-4-5-13(15)14(16)10-12/h4-5,10,17,19H,2-3,6-9,11H2,1H3 |
| InChIKey | GYVQJUQPHMOBHS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|