C12H18Cl2N2O — CID 17214269
2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]ethanol (PubChem CID 17214269) has the molecular formula C12H18Cl2N2O and a molecular weight of 277.19 g/mol. Its IUPAC name is 2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]ethanol.
| Compound Name | 2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]ethanol |
|---|---|
| PubChem CID | 17214269 |
| Molecular Formula | C12H18Cl2N2O |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]ethanol |
| SMILES | OCCNCCCNCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H18Cl2N2O/c13-11-3-2-10(8-12(11)14)9-16-5-1-4-15-6-7-17/h2-3,8,15-17H,1,4-7,9H2 |
| InChIKey | VJNZEFWAMRRXDU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|