C17H28Cl2N2 — CID 135305476
N',N'-dibutyl-N-[(3,4-dichlorophenyl)methyl]ethane-1,2-diamine (PubChem CID 135305476) has the molecular formula C17H28Cl2N2 and a molecular weight of 331.33 g/mol. Its IUPAC name is N',N'-dibutyl-N-[(3,4-dichlorophenyl)methyl]ethane-1,2-diamine.
| Compound Name | N',N'-dibutyl-N-[(3,4-dichlorophenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 135305476 |
| Molecular Formula | C17H28Cl2N2 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N',N'-dibutyl-N-[(3,4-dichlorophenyl)methyl]ethane-1,2-diamine |
| SMILES | CCCCN(CCCC)CCNCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H28Cl2N2/c1-3-5-10-21(11-6-4-2)12-9-20-14-15-7-8-16(18)17(19)13-15/h7-8,13,20H,3-6,9-12,14H2,1-2H3 |
| InChIKey | QGLSJLWMBSGWDT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|