C13H19Cl2NO — CID 60689446
2-[butyl-[(3,4-dichlorophenyl)methyl]amino]ethanol (PubChem CID 60689446) has the molecular formula C13H19Cl2NO and a molecular weight of 276.21 g/mol. Its IUPAC name is 2-[butyl-[(3,4-dichlorophenyl)methyl]amino]ethanol.
| Compound Name | 2-[butyl-[(3,4-dichlorophenyl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 60689446 |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-[butyl-[(3,4-dichlorophenyl)methyl]amino]ethanol |
| SMILES | CCCCN(CCO)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H19Cl2NO/c1-2-3-6-16(7-8-17)10-11-4-5-12(14)13(15)9-11/h4-5,9,17H,2-3,6-8,10H2,1H3 |
| InChIKey | YLFLWPICJRSHHR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |