C13H17Cl2NO2 — CID 82327861
3-[(3,4-dichlorophenyl)methyl-propylamino]propanoic acid (PubChem CID 82327861) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl-propylamino]propanoic acid.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl-propylamino]propanoic acid |
|---|---|
| PubChem CID | 82327861 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl-propylamino]propanoic acid |
| SMILES | CCCN(CCC(=O)O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NO2/c1-2-6-16(7-5-13(17)18)9-10-3-4-11(14)12(15)8-10/h3-4,8H,2,5-7,9H2,1H3,(H,17,18) |
| InChIKey | PQLKRRYALJMOJM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |