C13H20BrClN2 — CID 83235269
N-[(3-bromo-4-chlorophenyl)methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 83235269) has the molecular formula C13H20BrClN2 and a molecular weight of 319.67 g/mol. Its IUPAC name is N-[(3-bromo-4-chlorophenyl)methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[(3-bromo-4-chlorophenyl)methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 83235269 |
| Molecular Formula | C13H20BrClN2 |
| Molecular Weight | 319.67 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-[(3-bromo-4-chlorophenyl)methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C13H20BrClN2/c1-3-17(4-2)8-7-16-10-11-5-6-13(15)12(14)9-11/h5-6,9,16H,3-4,7-8,10H2,1-2H3 |
| InChIKey | OQXVSASDLNKPCK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.67 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|