C17H29BrN2O — CID 29241414
N-[(3-bromo-4-propoxyphenyl)methyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 29241414) has the molecular formula C17H29BrN2O and a molecular weight of 357.34 g/mol. Its IUPAC name is N-[(3-bromo-4-propoxyphenyl)methyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[(3-bromo-4-propoxyphenyl)methyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 29241414 |
| Molecular Formula | C17H29BrN2O |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[(3-bromo-4-propoxyphenyl)methyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCCOc1ccc(CNCCCN(CC)CC)cc1Br |
| InChI | InChI=1S/C17H29BrN2O/c1-4-12-21-17-9-8-15(13-16(17)18)14-19-10-7-11-20(5-2)6-3/h8-9,13,19H,4-7,10-12,14H2,1-3H3 |
| InChIKey | APYSAFBCNNPRQX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|