C13H18Cl2N2O4 — CID 163327159
N-[(3,4-dichlorophenyl)methyl]-N',N'-dimethylethane-1,2-diamine;oxalic acid (PubChem CID 163327159) has the molecular formula C13H18Cl2N2O4 and a molecular weight of 337.20 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N',N'-dimethylethane-1,2-diamine;oxalic acid.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N',N'-dimethylethane-1,2-diamine;oxalic acid |
|---|---|
| PubChem CID | 163327159 |
| Molecular Formula | C13H18Cl2N2O4 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N',N'-dimethylethane-1,2-diamine;oxalic acid |
| SMILES | CN(C)CCNCc1ccc(Cl)c(Cl)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H16Cl2N2.C2H2O4/c1-15(2)6-5-14-8-9-3-4-10(12)11(13)7-9;3-1(4)2(5)6/h3-4,7,14H,5-6,8H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | QYICDLGELULFCC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|