C11H18N2O2 — CID 4663866
4-[[2-(dimethylamino)ethylamino]methyl]benzene-1,2-diol (PubChem CID 4663866) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-[[2-(dimethylamino)ethylamino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[2-(dimethylamino)ethylamino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 4663866 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4-[[2-(dimethylamino)ethylamino]methyl]benzene-1,2-diol |
| SMILES | CN(C)CCNCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H18N2O2/c1-13(2)6-5-12-8-9-3-4-10(14)11(15)7-9/h3-4,7,12,14-15H,5-6,8H2,1-2H3 |
| InChIKey | LCBTUDIELATKFG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|