C10H15NO3 — CID 28714440
4-[(3-hydroxypropylamino)methyl]benzene-1,2-diol (PubChem CID 28714440) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 4-[(3-hydroxypropylamino)methyl]benzene-1,2-diol.
| Compound Name | 4-[(3-hydroxypropylamino)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 28714440 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 4-[(3-hydroxypropylamino)methyl]benzene-1,2-diol |
| SMILES | OCCCNCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H15NO3/c12-5-1-4-11-7-8-2-3-9(13)10(14)6-8/h2-3,6,11-14H,1,4-5,7H2 |
| InChIKey | ZYUTWYCCGACJBR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|