C10H15N3O3 — CID 83111530
2-[(3,4-dihydroxyphenyl)methylamino]ethylurea (PubChem CID 83111530) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)methylamino]ethylurea.
| Compound Name | 2-[(3,4-dihydroxyphenyl)methylamino]ethylurea |
|---|---|
| PubChem CID | 83111530 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)methylamino]ethylurea |
| SMILES | NC(=O)NCCNCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H15N3O3/c11-10(16)13-4-3-12-6-7-1-2-8(14)9(15)5-7/h1-2,5,12,14-15H,3-4,6H2,(H3,11,13,16) |
| InChIKey | QQCJDRRJMBKACX-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|