C9H11NO4 — CID 43135200
2-[(3,4-dihydroxyphenyl)methylamino]acetic acid (PubChem CID 43135200) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)methylamino]acetic acid.
| Compound Name | 2-[(3,4-dihydroxyphenyl)methylamino]acetic acid |
|---|---|
| PubChem CID | 43135200 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)methylamino]acetic acid |
| SMILES | O=C(O)CNCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H11NO4/c11-7-2-1-6(3-8(7)12)4-10-5-9(13)14/h1-3,10-12H,4-5H2,(H,13,14) |
| InChIKey | XNIIMJVOKAQSKZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|