C10H11NO4 — CID 174910195
N-[(3,4-dihydroxyphenyl)methyl]-2-hydroxyprop-2-enamide (PubChem CID 174910195) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is N-[(3,4-dihydroxyphenyl)methyl]-2-hydroxyprop-2-enamide.
| Compound Name | N-[(3,4-dihydroxyphenyl)methyl]-2-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 174910195 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | N-[(3,4-dihydroxyphenyl)methyl]-2-hydroxyprop-2-enamide |
| SMILES | C=C(O)C(=O)NCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H11NO4/c1-6(12)10(15)11-5-7-2-3-8(13)9(14)4-7/h2-4,12-14H,1,5H2,(H,11,15) |
| InChIKey | YEKBDKHFLCJXCU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|