C13H11NO4S — CID 10564469
N-[(3,4-dihydroxyphenyl)methyl]-2-oxo-2-thiophen-2-ylacetamide (PubChem CID 10564469) has the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. Its IUPAC name is N-[(3,4-dihydroxyphenyl)methyl]-2-oxo-2-thiophen-2-ylacetamide.
| Compound Name | N-[(3,4-dihydroxyphenyl)methyl]-2-oxo-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 10564469 |
| Molecular Formula | C13H11NO4S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | N-[(3,4-dihydroxyphenyl)methyl]-2-oxo-2-thiophen-2-ylacetamide |
| SMILES | O=C(NCc1ccc(O)c(O)c1)C(=O)c1cccs1 |
| InChI | InChI=1S/C13H11NO4S/c15-9-4-3-8(6-10(9)16)7-14-13(18)12(17)11-2-1-5-19-11/h1-6,15-16H,7H2,(H,14,18) |
| InChIKey | IAFDNXAISMSSOE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|