C15H18N2O3S — CID 61148881
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(2-thiophen-2-ylethyl)propanamide (PubChem CID 61148881) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(2-thiophen-2-ylethyl)propanamide.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 61148881 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(2-thiophen-2-ylethyl)propanamide |
| SMILES | N[C@@H](Cc1ccc(O)c(O)c1)C(=O)NCCc1cccs1 |
| InChI | InChI=1S/C15H18N2O3S/c16-12(8-10-3-4-13(18)14(19)9-10)15(20)17-6-5-11-2-1-7-21-11/h1-4,7,9,12,18-19H,5-6,8,16H2,(H,17,20)/t12-/m0/s1 |
| InChIKey | IWUWTKREFSEASK-LBPRGKRZSA-N |
| XLogP | 1.39 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|