C14H15NO4S — CID 43727664
3-[(3,4-dihydroxyphenyl)methylamino]-3-thiophen-2-ylpropanoic acid (PubChem CID 43727664) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 3-[(3,4-dihydroxyphenyl)methylamino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[(3,4-dihydroxyphenyl)methylamino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 43727664 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-[(3,4-dihydroxyphenyl)methylamino]-3-thiophen-2-ylpropanoic acid |
| SMILES | O=C(O)CC(NCc1ccc(O)c(O)c1)c1cccs1 |
| InChI | InChI=1S/C14H15NO4S/c16-11-4-3-9(6-12(11)17)8-15-10(7-14(18)19)13-2-1-5-20-13/h1-6,10,15-17H,7-8H2,(H,18,19) |
| InChIKey | SLZMWEXTFDLBEU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|