C12H14N2O2S2 — CID 66385558
3-[(3-aminothiophen-2-yl)methylamino]-3-thiophen-2-ylpropanoic acid (PubChem CID 66385558) has the molecular formula C12H14N2O2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-[(3-aminothiophen-2-yl)methylamino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[(3-aminothiophen-2-yl)methylamino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 66385558 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 3-[(3-aminothiophen-2-yl)methylamino]-3-thiophen-2-ylpropanoic acid |
| SMILES | Nc1ccsc1CNC(CC(=O)O)c1cccs1 |
| InChI | InChI=1S/C12H14N2O2S2/c13-8-3-5-18-11(8)7-14-9(6-12(15)16)10-2-1-4-17-10/h1-5,9,14H,6-7,13H2,(H,15,16) |
| InChIKey | LOBXJIAUZUMDSX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |