C12H14N2O2S — CID 62329407
3-(1H-pyrrol-2-ylmethylamino)-3-thiophen-2-ylpropanoic acid (PubChem CID 62329407) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 3-(1H-pyrrol-2-ylmethylamino)-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-(1H-pyrrol-2-ylmethylamino)-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 62329407 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 3-(1H-pyrrol-2-ylmethylamino)-3-thiophen-2-ylpropanoic acid |
| SMILES | O=C(O)CC(NCc1ccc[nH]1)c1cccs1 |
| InChI | InChI=1S/C12H14N2O2S/c15-12(16)7-10(11-4-2-6-17-11)14-8-9-3-1-5-13-9/h1-6,10,13-14H,7-8H2,(H,15,16) |
| InChIKey | CLXIJYUKWPKYSE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |