C14H14BrNO3S — CID 107737763
3-[(5-bromo-2-hydroxyphenyl)methylamino]-3-thiophen-2-ylpropanoic acid (PubChem CID 107737763) has the molecular formula C14H14BrNO3S and a molecular weight of 356.24 g/mol. Its IUPAC name is 3-[(5-bromo-2-hydroxyphenyl)methylamino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[(5-bromo-2-hydroxyphenyl)methylamino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 107737763 |
| Molecular Formula | C14H14BrNO3S |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 3-[(5-bromo-2-hydroxyphenyl)methylamino]-3-thiophen-2-ylpropanoic acid |
| SMILES | O=C(O)CC(NCc1cc(Br)ccc1O)c1cccs1 |
| InChI | InChI=1S/C14H14BrNO3S/c15-10-3-4-12(17)9(6-10)8-16-11(7-14(18)19)13-2-1-5-20-13/h1-6,11,16-17H,7-8H2,(H,18,19) |
| InChIKey | HSOMDCRUKKQLCL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|