C12H17NO3 — CID 67129617
N-[(3,4-dihydroxyphenyl)methyl]-2,2-dimethylpropanamide (PubChem CID 67129617) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is N-[(3,4-dihydroxyphenyl)methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(3,4-dihydroxyphenyl)methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 67129617 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | N-[(3,4-dihydroxyphenyl)methyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H17NO3/c1-12(2,3)11(16)13-7-8-4-5-9(14)10(15)6-8/h4-6,14-15H,7H2,1-3H3,(H,13,16) |
| InChIKey | YSYPKVKPFRQONQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|